C21H27ClN2O7 — CID 25054369
3-O-ethyl 5-O-methyl (4S)-2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;formic acid (PubChem CID 25054369) has the molecular formula C21H27ClN2O7 and a molecular weight of 454.91 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl (4S)-2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;formic acid.
| Compound Name | 3-O-ethyl 5-O-methyl (4S)-2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;formic acid |
|---|---|
| PubChem CID | 25054369 |
| Molecular Formula | C21H27ClN2O7 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-O-ethyl 5-O-methyl (4S)-2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;formic acid |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)[C@@H]1c1ccccc1Cl.O=CO |
| InChI | InChI=1S/C20H25ClN2O5.CH2O2/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;2-1-3/h5-8,17,23H,4,9-11,22H2,1-3H3;1H,(H,2,3)/t17-;/m0./s1 |
| InChIKey | NAISDGBLWCKQBC-LMOVPXPDSA-N |
| XLogP | 1.97 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|