C17H20N6O2 — CID 25054713
1-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-(5-methylimidazol-1-yl)propyl]guanidine (PubChem CID 25054713) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-(5-methylimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-(5-methylimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 25054713 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-(5-methylimidazol-1-yl)propyl]guanidine |
| SMILES | Cc1cncn1CCC/N=C(\NC#N)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H20N6O2/c1-13-10-19-12-23(13)6-2-5-20-17(21-11-18)22-14-3-4-15-16(9-14)25-8-7-24-15/h3-4,9-10,12H,2,5-8H2,1H3,(H2,20,21,22) |
| InChIKey | MTVNYDIMGJIWEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|