C27H26FN5O2 — CID 25054739
tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)-4-fluoroanilino]-2-pyridinyl]carbamate (PubChem CID 25054739) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)-4-fluoroanilino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)-4-fluoroanilino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 25054739 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)-4-fluoroanilino]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(N(c2ccc(F)cc2)C(c2cccnc2)c2cccnc2)n1 |
| InChI | InChI=1S/C27H26FN5O2/c1-27(2,3)35-26(34)32-23-9-4-10-24(31-23)33(22-13-11-21(28)12-14-22)25(19-7-5-15-29-17-19)20-8-6-16-30-18-20/h4-18,25H,1-3H3,(H,31,32,34) |
| InChIKey | WSPRWRDIINBAOF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |