C30H27FN2O4 — CID 25055192
(4R,5R)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)imidazolidin-2-one (PubChem CID 25055192) has the molecular formula C30H27FN2O4 and a molecular weight of 498.55 g/mol. Its IUPAC name is (4R,5R)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)imidazolidin-2-one.
| Compound Name | (4R,5R)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 25055192 |
| Molecular Formula | C30H27FN2O4 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (4R,5R)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)imidazolidin-2-one |
| SMILES | O=C1N[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(O)cc2O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27FN2O4/c31-22-10-6-21(7-11-22)27(35)17-16-26-29(25-15-14-24(34)18-28(25)36)33(30(37)32-26)23-12-8-20(9-13-23)19-4-2-1-3-5-19/h1-15,18,26-27,29,34-36H,16-17H2,(H,32,37)/t26-,27+,29-/m1/s1 |
| InChIKey | ICSZPMVTUIKQAN-IUAQSZDVSA-N |
| XLogP | 6.06 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|