C21H15Cl2F2N3O4 — CID 25055218
5-chloro-3-[2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 25055218) has the molecular formula C21H15Cl2F2N3O4 and a molecular weight of 482.27 g/mol. Its IUPAC name is 5-chloro-3-[2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-chloro-3-[2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 25055218 |
| Molecular Formula | C21H15Cl2F2N3O4 |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 5-chloro-3-[2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | COc1cc(Cl)c(-n2c(=O)[nH]c3ccc(Cl)nc32)cc1OCc1c(OC)ccc(F)c1F |
| InChI | InChI=1S/C21H15Cl2F2N3O4/c1-30-15-5-3-12(24)19(25)10(15)9-32-17-8-14(11(22)7-16(17)31-2)28-20-13(26-21(28)29)4-6-18(23)27-20/h3-8H,9H2,1-2H3,(H,26,29) |
| InChIKey | YUOXGZGRQKGOHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|