C23H26F3N3O4S — CID 25055227
[4-[[(2S)-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamoyl]phenyl] trifluoromethanesulfonate (PubChem CID 25055227) has the molecular formula C23H26F3N3O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is [4-[[(2S)-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[(2S)-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 25055227 |
| Molecular Formula | C23H26F3N3O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [4-[[(2S)-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamoyl]phenyl] trifluoromethanesulfonate |
| SMILES | CN1CCN(c2cccc3c2C[C@@H](NC(=O)c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC3)CC1 |
| InChI | InChI=1S/C23H26F3N3O4S/c1-28-11-13-29(14-12-28)21-4-2-3-16-5-8-18(15-20(16)21)27-22(30)17-6-9-19(10-7-17)33-34(31,32)23(24,25)26/h2-4,6-7,9-10,18H,5,8,11-15H2,1H3,(H,27,30)/t18-/m0/s1 |
| InChIKey | YABHVRJKXNUIGN-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|