C36H31FN2O4 — CID 25055445
(4R,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-1-(4-phenylphenyl)imidazolidin-2-one (PubChem CID 25055445) has the molecular formula C36H31FN2O4 and a molecular weight of 574.65 g/mol. Its IUPAC name is (4R,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-1-(4-phenylphenyl)imidazolidin-2-one.
| Compound Name | (4R,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-1-(4-phenylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 25055445 |
| Molecular Formula | C36H31FN2O4 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (4R,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-1-(4-phenylphenyl)imidazolidin-2-one |
| SMILES | O=C1N[C@H](CCC(O)c2ccc(F)cc2)[C@@H](c2ccc(-c3cccc(O)c3)cc2O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H31FN2O4/c37-28-14-9-25(10-15-28)33(41)20-19-32-35(31-18-13-27(22-34(31)42)26-7-4-8-30(40)21-26)39(36(43)38-32)29-16-11-24(12-17-29)23-5-2-1-3-6-23/h1-18,21-22,32-33,35,40-42H,19-20H2,(H,38,43)/t32-,33?,35-/m1/s1 |
| InChIKey | QWFNACUYCMYGJJ-VGPZTINSSA-N |
| XLogP | 7.72 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|