About 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol
2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol (PubChem CID 25055504) has the molecular formula C22H26FN3O
and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol |
| PubChem CID | 25055504 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol |
| SMILES | CC(C)(C)Cc1cnc(C(C)(O)Cc2ccc(-c3ccc(F)cn3)cc2)[nH]1 |
| InChI | InChI=1S/C22H26FN3O/c1-21(2,3)12-18-14-25-20(26-18)22(4,27)11-15-5-7-16(8-6-15)19-10-9-17(23)13-24-19/h5-10,13-14,27H,11-12H2,1-4H3,(H,25,26) |
| InChIKey | WFOBNYAVMIYRCG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol?
The IUPAC name of 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol (CID 25055504) is 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol.
What is the SMILES notation for 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol?
The canonical SMILES for 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol is CC(C)(C)Cc1cnc(C(C)(O)Cc2ccc(-c3ccc(F)cn3)cc2)[nH]1.
What is the InChIKey of 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol?
The InChIKey is WFOBNYAVMIYRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26FN3O/c1-21(2,3)12-18-14-25-20(26-18)22(4,27)11-15-5-7-16(8-6-15)19-10-9-17(23)13-24-19/h5-10,13-14,27H,11-12H2,1-4H3,(H,25,26).
What are the key properties of 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol?
2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol has a molecular weight of 367.47 g/mol, XLogP of 4.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-1-[4-(5-fluoro-2-pyridinyl)phenyl]propan-2-ol is sourced from PubChem (CID 25055504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).