About (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine
(E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine (PubChem CID 25055692) has the molecular formula C15H16F3N5O2
and a molecular weight of 355.32 g/mol. Its IUPAC name is (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine |
| PubChem CID | 25055692 |
| Molecular Formula | C15H16F3N5O2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine |
| SMILES | O=[N+]([O-])/C=C(\NCCCn1ccnc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3N5O2/c16-15(17,18)12-2-4-13(5-3-12)21-14(10-23(24)25)20-6-1-8-22-9-7-19-11-22/h2-5,7,9-11,20-21H,1,6,8H2/b14-10+ |
| InChIKey | FICHGENUBRNSQB-GXDHUFHOSA-N |
| XLogP | 3.07 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine?
The IUPAC name of (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine (CID 25055692) is (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine.
What is the SMILES notation for (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine?
The canonical SMILES for (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine is O=[N+]([O-])/C=C(\NCCCn1ccnc1)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine?
The InChIKey is FICHGENUBRNSQB-GXDHUFHOSA-N. The full InChI is InChI=1S/C15H16F3N5O2/c16-15(17,18)12-2-4-13(5-3-12)21-14(10-23(24)25)20-6-1-8-22-9-7-19-11-22/h2-5,7,9-11,20-21H,1,6,8H2/b14-10+.
What are the key properties of (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine?
(E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine has a molecular weight of 355.32 g/mol, XLogP of 3.07, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N-(3-imidazol-1-ylpropyl)-2-nitro-1-N'-[4-(trifluoromethyl)phenyl]ethene-1,1-diamine is sourced from PubChem (CID 25055692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).