C21H23ClF3N3O2S — CID 25056092
3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-1,3-thiazolidine-2-carboxamide;hydrochloride (PubChem CID 25056092) has the molecular formula C21H23ClF3N3O2S and a molecular weight of 473.95 g/mol. Its IUPAC name is 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-1,3-thiazolidine-2-carboxamide;hydrochloride.
| Compound Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-1,3-thiazolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 25056092 |
| Molecular Formula | C21H23ClF3N3O2S |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-1,3-thiazolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCSC1C(=O)NCc1ccccc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H22F3N3O2S.ClH/c22-16-11-18(24)17(23)9-14(16)8-15(25)10-19(28)27-6-7-30-21(27)20(29)26-12-13-4-2-1-3-5-13;/h1-5,9,11,15,21H,6-8,10,12,25H2,(H,26,29);1H/t15-,21?;/m1./s1 |
| InChIKey | NGZZRNQZCOOQHZ-NBDGTZBISA-N |
| XLogP | 3.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|