C22H18F3N3O3 — CID 25056111
4-phenyl-7-[[4-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]triazol-1-yl]methyl]chromen-2-one (PubChem CID 25056111) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is 4-phenyl-7-[[4-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]triazol-1-yl]methyl]chromen-2-one.
| Compound Name | 4-phenyl-7-[[4-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]triazol-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 25056111 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-phenyl-7-[[4-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]triazol-1-yl]methyl]chromen-2-one |
| SMILES | CC[C@](O)(c1cn(Cc2ccc3c(-c4ccccc4)cc(=O)oc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C22H18F3N3O3/c1-2-21(30,22(23,24)25)19-13-28(27-26-19)12-14-8-9-16-17(15-6-4-3-5-7-15)11-20(29)31-18(16)10-14/h3-11,13,30H,2,12H2,1H3/t21-/m0/s1 |
| InChIKey | TZHDDEFSMSEZJZ-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|