C27H37Cl2N3O — CID 25056323
2-(4-cyclohexylpiperazin-1-yl)-N-[2-(3,5-dichlorophenyl)ethyl]-2-(4-methoxyphenyl)ethanamine (PubChem CID 25056323) has the molecular formula C27H37Cl2N3O and a molecular weight of 490.52 g/mol. Its IUPAC name is 2-(4-cyclohexylpiperazin-1-yl)-N-[2-(3,5-dichlorophenyl)ethyl]-2-(4-methoxyphenyl)ethanamine.
| Compound Name | 2-(4-cyclohexylpiperazin-1-yl)-N-[2-(3,5-dichlorophenyl)ethyl]-2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 25056323 |
| Molecular Formula | C27H37Cl2N3O |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-(4-cyclohexylpiperazin-1-yl)-N-[2-(3,5-dichlorophenyl)ethyl]-2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(CNCCc2cc(Cl)cc(Cl)c2)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C27H37Cl2N3O/c1-33-26-9-7-22(8-10-26)27(20-30-12-11-21-17-23(28)19-24(29)18-21)32-15-13-31(14-16-32)25-5-3-2-4-6-25/h7-10,17-19,25,27,30H,2-6,11-16,20H2,1H3 |
| InChIKey | IVBOWJNCCCSGMB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|