C29H32F2N4O4 — CID 25057483
2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 25057483) has the molecular formula C29H32F2N4O4 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 25057483 |
| Molecular Formula | C29H32F2N4O4 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | COc1ccc2nccc(/C=C/[C@@H]3CC[C@@H](NC/C=C/c4cc(F)ccc4F)[C@@H](CC(=O)NCCO)O3)c2n1 |
| InChI | InChI=1S/C29H32F2N4O4/c1-38-28-11-10-25-29(35-28)19(12-14-33-25)4-6-22-7-9-24(26(39-22)18-27(37)34-15-16-36)32-13-2-3-20-17-21(30)5-8-23(20)31/h2-6,8,10-12,14,17,22,24,26,32,36H,7,9,13,15-16,18H2,1H3,(H,34,37)/b3-2+,6-4+/t22-,24-,26-/m1/s1 |
| InChIKey | TXALGLMMOCTFRM-MCLDETKNSA-N |
| XLogP | 3.65 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |