C19H20F3N3O3S — CID 25057648
3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(furan-3-ylmethyl)-1,3-thiazolidine-2-carboxamide (PubChem CID 25057648) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(furan-3-ylmethyl)-1,3-thiazolidine-2-carboxamide.
| Compound Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(furan-3-ylmethyl)-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 25057648 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(furan-3-ylmethyl)-1,3-thiazolidine-2-carboxamide |
| SMILES | N[C@@H](CC(=O)N1CCSC1C(=O)NCc1ccoc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H20F3N3O3S/c20-14-8-16(22)15(21)6-12(14)5-13(23)7-17(26)25-2-4-29-19(25)18(27)24-9-11-1-3-28-10-11/h1,3,6,8,10,13,19H,2,4-5,7,9,23H2,(H,24,27)/t13-,19?/m1/s1 |
| InChIKey | WNARSKYZQJFIEA-BSOCMFCZSA-N |
| XLogP | 2.17 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|