C22H22F3N5O2S — CID 25057919
3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(1H-benzimidazol-2-ylmethyl)-1,3-thiazolidine-2-carboxamide (PubChem CID 25057919) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(1H-benzimidazol-2-ylmethyl)-1,3-thiazolidine-2-carboxamide.
| Compound Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(1H-benzimidazol-2-ylmethyl)-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 25057919 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(1H-benzimidazol-2-ylmethyl)-1,3-thiazolidine-2-carboxamide |
| SMILES | N[C@@H](CC(=O)N1CCSC1C(=O)NCc1nc2ccccc2[nH]1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H22F3N5O2S/c23-14-10-16(25)15(24)8-12(14)7-13(26)9-20(31)30-5-6-33-22(30)21(32)27-11-19-28-17-3-1-2-4-18(17)29-19/h1-4,8,10,13,22H,5-7,9,11,26H2,(H,27,32)(H,28,29)/t13-,22?/m1/s1 |
| InChIKey | NCEDLMUAOLHRAJ-BXWDTWGJSA-N |
| XLogP | 2.46 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|