C27H18N2O3 — CID 25058236
2-[(5E)-5-(3-oxo-2-phenylisoindol-1-ylidene)pent-3-ynyl]isoindole-1,3-dione (PubChem CID 25058236) has the molecular formula C27H18N2O3 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[(5E)-5-(3-oxo-2-phenylisoindol-1-ylidene)pent-3-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[(5E)-5-(3-oxo-2-phenylisoindol-1-ylidene)pent-3-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25058236 |
| Molecular Formula | C27H18N2O3 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[(5E)-5-(3-oxo-2-phenylisoindol-1-ylidene)pent-3-ynyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC#C/C=C1\c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H18N2O3/c30-25-22-15-8-9-16-23(22)26(31)28(25)18-10-2-5-17-24-20-13-6-7-14-21(20)27(32)29(24)19-11-3-1-4-12-19/h1,3-4,6-9,11-17H,10,18H2/b24-17+ |
| InChIKey | OLXIANGHSRGXLV-JJIBRWJFSA-N |
| XLogP | 4.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|