About 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline
7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 25058395) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline.
Molecular Properties
| Compound Name | 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline |
| PubChem CID | 25058395 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | c1nc(CCO[C@H]2CCCCO2)cc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C17H19NO4/c1-2-5-19-17(3-1)20-6-4-14-7-12-8-15-16(22-11-21-15)9-13(12)10-18-14/h7-10,17H,1-6,11H2/t17-/m0/s1 |
| InChIKey | RPVJCUALGUABSP-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline?
The IUPAC name of 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline (CID 25058395) is 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline.
What is the SMILES notation for 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline?
The canonical SMILES for 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline is c1nc(CCO[C@H]2CCCCO2)cc2cc3c(cc12)OCO3.
What is the InChIKey of 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline?
The InChIKey is RPVJCUALGUABSP-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H19NO4/c1-2-5-19-17(3-1)20-6-4-14-7-12-8-15-16(22-11-21-15)9-13(12)10-18-14/h7-10,17H,1-6,11H2/t17-/m0/s1.
What are the key properties of 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline?
7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline has a molecular weight of 301.34 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[(2S)-oxan-2-yl]oxyethyl]-[1,3]dioxolo[4,5-g]isoquinoline is sourced from PubChem (CID 25058395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).