C17H35BO2Si — CID 25058449
tri(propan-2-yl)-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane (PubChem CID 25058449) has the molecular formula C17H35BO2Si and a molecular weight of 310.36 g/mol. Its IUPAC name is tri(propan-2-yl)-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane.
| Compound Name | tri(propan-2-yl)-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
|---|---|
| PubChem CID | 25058449 |
| Molecular Formula | C17H35BO2Si |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | tri(propan-2-yl)-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
| SMILES | CC(C)[Si](/C=C\B1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H35BO2Si/c1-13(2)21(14(3)4,15(5)6)12-11-18-19-16(7,8)17(9,10)20-18/h11-15H,1-10H3/b12-11- |
| InChIKey | ULCPHYRDJLVHQK-QXMHVHEDSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|