C16H16O4 — CID 25058730
(2S,5S,9S)-9-ethenyl-9-methyl-2-phenyl-1,7-dioxaspiro[4.4]nonane-4,6-dione (PubChem CID 25058730) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S,5S,9S)-9-ethenyl-9-methyl-2-phenyl-1,7-dioxaspiro[4.4]nonane-4,6-dione.
| Compound Name | (2S,5S,9S)-9-ethenyl-9-methyl-2-phenyl-1,7-dioxaspiro[4.4]nonane-4,6-dione |
|---|---|
| PubChem CID | 25058730 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2S,5S,9S)-9-ethenyl-9-methyl-2-phenyl-1,7-dioxaspiro[4.4]nonane-4,6-dione |
| SMILES | C=C[C@@]1(C)COC(=O)[C@]12O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C16H16O4/c1-3-15(2)10-19-14(18)16(15)13(17)9-12(20-16)11-7-5-4-6-8-11/h3-8,12H,1,9-10H2,2H3/t12-,15-,16-/m0/s1 |
| InChIKey | MICHQRVEGOKKHX-RCBQFDQVSA-N |
| XLogP | 2.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|