C20H38O4Si — CID 25058807
(1Z,3R)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-ol (PubChem CID 25058807) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (1Z,3R)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-ol.
| Compound Name | (1Z,3R)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 25058807 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (1Z,3R)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-ol |
| SMILES | C=CC[C@@H](O)/C=C\[C@@H]1C[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C20H38O4Si/c1-10-11-16(21)12-13-17-14-18(23-20(6,7)22-17)15(2)24-25(8,9)19(3,4)5/h10,12-13,15-18,21H,1,11,14H2,2-9H3/b13-12-/t15-,16+,17+,18+/m0/s1 |
| InChIKey | FDPZIJFGBHTCCH-NBILACBVSA-N |
| XLogP | 4.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|