C34H46O4Si — CID 25058838
tert-butyl-[[(12S,15S,16S)-4-methoxy-5-[(4-methoxyphenyl)methoxy]-16-methyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,9-pentaenyl]oxy]-dimethylsilane (PubChem CID 25058838) has the molecular formula C34H46O4Si and a molecular weight of 546.82 g/mol. Its IUPAC name is tert-butyl-[[(12S,15S,16S)-4-methoxy-5-[(4-methoxyphenyl)methoxy]-16-methyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,9-pentaenyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(12S,15S,16S)-4-methoxy-5-[(4-methoxyphenyl)methoxy]-16-methyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,9-pentaenyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 25058838 |
| Molecular Formula | C34H46O4Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | tert-butyl-[[(12S,15S,16S)-4-methoxy-5-[(4-methoxyphenyl)methoxy]-16-methyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,9-pentaenyl]oxy]-dimethylsilane |
| SMILES | COc1ccc(COc2ccc3c(c2OC)CC2=C(C=C3)[C@@H]3CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC2)cc1 |
| InChI | InChI=1S/C34H46O4Si/c1-33(2,3)39(7,8)38-31-18-16-29-27-15-11-24-12-17-30(37-22-23-9-13-26(35-5)14-10-23)32(36-6)28(24)21-25(27)19-20-34(29,31)4/h9-15,17,29,31H,16,18-22H2,1-8H3/t29-,31-,34-/m0/s1 |
| InChIKey | SPXRSCHKHZODJH-ZYPSJOPPSA-N |
| XLogP | 8.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|