C29H46O5Si — CID 25058881
(Z,1R,2R,3R)-1-(furan-2-yl)-1-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-6-tri(propan-2-yl)silyloxyhex-4-en-3-ol (PubChem CID 25058881) has the molecular formula C29H46O5Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (Z,1R,2R,3R)-1-(furan-2-yl)-1-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-6-tri(propan-2-yl)silyloxyhex-4-en-3-ol.
| Compound Name | (Z,1R,2R,3R)-1-(furan-2-yl)-1-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-6-tri(propan-2-yl)silyloxyhex-4-en-3-ol |
|---|---|
| PubChem CID | 25058881 |
| Molecular Formula | C29H46O5Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (Z,1R,2R,3R)-1-(furan-2-yl)-1-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-6-tri(propan-2-yl)silyloxyhex-4-en-3-ol |
| SMILES | COc1ccc(CO[C@@H](c2ccco2)[C@H](C)[C@@H](O)/C(C)=C\CO[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C29H46O5Si/c1-20(2)35(21(3)4,22(5)6)34-18-16-23(7)28(30)24(8)29(27-11-10-17-32-27)33-19-25-12-14-26(31-9)15-13-25/h10-17,20-22,24,28-30H,18-19H2,1-9H3/b23-16-/t24-,28+,29-/m1/s1 |
| InChIKey | DGRNVLFEHIZTIK-NILGFZGYSA-N |
| XLogP | 7.68 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|