C15H28O4 — CID 25059017
ethyl 2-[(4R,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]acetate (PubChem CID 25059017) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is ethyl 2-[(4R,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 25059017 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | ethyl 2-[(4R,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCCCC[C@@H]1C[C@H](CC(=O)OCC)OC(C)(C)O1 |
| InChI | InChI=1S/C15H28O4/c1-5-7-8-9-12-10-13(11-14(16)17-6-2)19-15(3,4)18-12/h12-13H,5-11H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | PXYLGNFVECTYFH-CHWSQXEVSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|