About 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene
4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene (PubChem CID 25059054) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene.
Molecular Properties
| Compound Name | 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene |
| PubChem CID | 25059054 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene |
| SMILES | CC1=CC=CC12CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C13H18O2/c1-11-3-2-4-12(11)5-7-13(8-6-12)14-9-10-15-13/h2-4H,5-10H2,1H3 |
| InChIKey | VKLIONSWOHUUEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene?
The IUPAC name of 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene (CID 25059054) is 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene.
What is the SMILES notation for 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene?
The canonical SMILES for 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene is CC1=CC=CC12CCC1(CC2)OCCO1.
What is the InChIKey of 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene?
The InChIKey is VKLIONSWOHUUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-11-3-2-4-12(11)5-7-13(8-6-12)14-9-10-15-13/h2-4H,5-10H2,1H3.
What are the key properties of 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene?
4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene has a molecular weight of 206.28 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-9,12-dioxadispiro[4.2.48.25]tetradeca-1,3-diene is sourced from PubChem (CID 25059054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).