C18H18BrFN6O — CID 25059146
7-bromo-3-[(3-fluorophenyl)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one (PubChem CID 25059146) has the molecular formula C18H18BrFN6O and a molecular weight of 433.29 g/mol. Its IUPAC name is 7-bromo-3-[(3-fluorophenyl)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one.
| Compound Name | 7-bromo-3-[(3-fluorophenyl)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
|---|---|
| PubChem CID | 25059146 |
| Molecular Formula | C18H18BrFN6O |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 7-bromo-3-[(3-fluorophenyl)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
| SMILES | CCCCCn1c2nc(Br)[nH]c2c(=O)n2c(Cc3cccc(F)c3)nnc12 |
| InChI | InChI=1S/C18H18BrFN6O/c1-2-3-4-8-25-15-14(21-17(19)22-15)16(27)26-13(23-24-18(25)26)10-11-6-5-7-12(20)9-11/h5-7,9H,2-4,8,10H2,1H3,(H,21,22) |
| InChIKey | HDCIOVUANZXOFS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|