C24H31N5OS — CID 25059432
1-[4-amino-8-[2-(propan-2-ylamino)ethylsulfanyl]quinazolin-7-yl]-3,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 25059432) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-[4-amino-8-[2-(propan-2-ylamino)ethylsulfanyl]quinazolin-7-yl]-3,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-[4-amino-8-[2-(propan-2-ylamino)ethylsulfanyl]quinazolin-7-yl]-3,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 25059432 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[4-amino-8-[2-(propan-2-ylamino)ethylsulfanyl]quinazolin-7-yl]-3,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1cn(-c2ccc3c(N)ncnc3c2SCCNC(C)C)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C24H31N5OS/c1-14(2)26-8-9-31-22-17(7-6-16-21(22)27-13-28-23(16)25)29-12-15(3)20-18(29)10-24(4,5)11-19(20)30/h6-7,12-14,26H,8-11H2,1-5H3,(H2,25,27,28) |
| InChIKey | ZKUDVBBMADRZIL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|