C26H29FN2O — CID 25059619
N-benzyl-6-fluoro-1'-prop-2-enylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine (PubChem CID 25059619) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is N-benzyl-6-fluoro-1'-prop-2-enylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine.
| Compound Name | N-benzyl-6-fluoro-1'-prop-2-enylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
|---|---|
| PubChem CID | 25059619 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-benzyl-6-fluoro-1'-prop-2-enylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
| SMILES | C=CCC1(NCc2ccccc2)CCC2(CC1)OCCc1c2[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C26H29FN2O/c1-2-11-25(28-18-19-6-4-3-5-7-19)12-14-26(15-13-25)24-21(10-16-30-26)22-17-20(27)8-9-23(22)29-24/h2-9,17,28-29H,1,10-16,18H2 |
| InChIKey | QRCDLOIQCWUGOB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|