About 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one
4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one (PubChem CID 25059818) has the molecular formula C20H29F3O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one.
Molecular Properties
| Compound Name | 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one |
| PubChem CID | 25059818 |
| Molecular Formula | C20H29F3O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one |
| SMILES | CCCCCCCCCCOc1ccc(CCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H29F3O2/c1-2-3-4-5-6-7-8-9-16-25-18-13-10-17(11-14-18)12-15-19(24)20(21,22)23/h10-11,13-14H,2-9,12,15-16H2,1H3 |
| InChIKey | DJDSHOVBFZKIEK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one?
The IUPAC name of 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one (CID 25059818) is 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one.
What is the SMILES notation for 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one?
The canonical SMILES for 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one is CCCCCCCCCCOc1ccc(CCC(=O)C(F)(F)F)cc1.
What is the InChIKey of 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one?
The InChIKey is DJDSHOVBFZKIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F3O2/c1-2-3-4-5-6-7-8-9-16-25-18-13-10-17(11-14-18)12-15-19(24)20(21,22)23/h10-11,13-14H,2-9,12,15-16H2,1H3.
What are the key properties of 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one?
4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one has a molecular weight of 358.44 g/mol, XLogP of 6.27, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-decoxyphenyl)-1,1,1-trifluorobutan-2-one is sourced from PubChem (CID 25059818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).