C14H25BrN2O2S — CID 25059874
2-[1-(aminomethyl)cyclohexyl]-N-[2-(3-bromo-2-oxopropyl)sulfanylethyl]acetamide (PubChem CID 25059874) has the molecular formula C14H25BrN2O2S and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-[2-(3-bromo-2-oxopropyl)sulfanylethyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-[2-(3-bromo-2-oxopropyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 25059874 |
| Molecular Formula | C14H25BrN2O2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-[2-(3-bromo-2-oxopropyl)sulfanylethyl]acetamide |
| SMILES | NCC1(CC(=O)NCCSCC(=O)CBr)CCCCC1 |
| InChI | InChI=1S/C14H25BrN2O2S/c15-9-12(18)10-20-7-6-17-13(19)8-14(11-16)4-2-1-3-5-14/h1-11,16H2,(H,17,19) |
| InChIKey | FPLWFFGKUQBEHW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|