About 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid
2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid (PubChem CID 25059980) has the molecular formula C27H25Cl2F3O4
and a molecular weight of 541.39 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid.
Molecular Properties
| Compound Name | 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid |
| PubChem CID | 25059980 |
| Molecular Formula | C27H25Cl2F3O4 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CCC(OCc2ccccc2)c2ccc(C(F)(F)F)cc2)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C27H25Cl2F3O4/c1-2-21(26(33)34)36-23-15-11-19(24(28)25(23)29)10-14-22(35-16-17-6-4-3-5-7-17)18-8-12-20(13-9-18)27(30,31)32/h3-9,11-13,15,21-22H,2,10,14,16H2,1H3,(H,33,34) |
| InChIKey | AEYMXPBQKYBJCN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid?
The IUPAC name of 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid (CID 25059980) is 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid.
What is the SMILES notation for 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid?
The canonical SMILES for 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid is CCC(Oc1ccc(CCC(OCc2ccccc2)c2ccc(C(F)(F)F)cc2)c(Cl)c1Cl)C(=O)O.
What is the InChIKey of 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid?
The InChIKey is AEYMXPBQKYBJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25Cl2F3O4/c1-2-21(26(33)34)36-23-15-11-19(24(28)25(23)29)10-14-22(35-16-17-6-4-3-5-7-17)18-8-12-20(13-9-18)27(30,31)32/h3-9,11-13,15,21-22H,2,10,14,16H2,1H3,(H,33,34).
What are the key properties of 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid?
2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid has a molecular weight of 541.39 g/mol, XLogP of 8.14, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dichloro-4-[3-phenylmethoxy-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid is sourced from PubChem (CID 25059980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).