About methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate
methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate (PubChem CID 25060001) has the molecular formula C28H26F2N2O3
and a molecular weight of 476.52 g/mol. Its IUPAC name is methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate |
| PubChem CID | 25060001 |
| Molecular Formula | C28H26F2N2O3 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C(=O)NCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H26F2N2O3/c1-17(2)26-25(27(33)31-15-19-9-12-22(29)23(30)13-19)21-11-10-20(28(34)35-3)14-24(21)32(26)16-18-7-5-4-6-8-18/h4-14,17H,15-16H2,1-3H3,(H,31,33) |
| InChIKey | VZSJMRWWPNKVNW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate?
The IUPAC name of methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate (CID 25060001) is methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate.
What is the SMILES notation for methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate?
The canonical SMILES for methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate is COC(=O)c1ccc2c(C(=O)NCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccc3)c2c1.
What is the InChIKey of methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate?
The InChIKey is VZSJMRWWPNKVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26F2N2O3/c1-17(2)26-25(27(33)31-15-19-9-12-22(29)23(30)13-19)21-11-10-20(28(34)35-3)14-24(21)32(26)16-18-7-5-4-6-8-18/h4-14,17H,15-16H2,1-3H3,(H,31,33).
What are the key properties of methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate?
methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate has a molecular weight of 476.52 g/mol, XLogP of 5.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzyl-3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-ylindole-6-carboxylate is sourced from PubChem (CID 25060001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).