C22H31N3O2 — CID 25060020
6-methoxy-1'-pentyl-1-phenylspiro[6,7-dihydropyrano[3,4-d]pyrazole-4,4'-piperidine] (PubChem CID 25060020) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 6-methoxy-1'-pentyl-1-phenylspiro[6,7-dihydropyrano[3,4-d]pyrazole-4,4'-piperidine].
| Compound Name | 6-methoxy-1'-pentyl-1-phenylspiro[6,7-dihydropyrano[3,4-d]pyrazole-4,4'-piperidine] |
|---|---|
| PubChem CID | 25060020 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 6-methoxy-1'-pentyl-1-phenylspiro[6,7-dihydropyrano[3,4-d]pyrazole-4,4'-piperidine] |
| SMILES | CCCCCN1CCC2(CC1)OC(OC)Cc1c2cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H31N3O2/c1-3-4-8-13-24-14-11-22(12-15-24)19-17-23-25(18-9-6-5-7-10-18)20(19)16-21(26-2)27-22/h5-7,9-10,17,21H,3-4,8,11-16H2,1-2H3 |
| InChIKey | RMVFRQIWSFNEFP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|