About 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine
9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine (PubChem CID 25060408) has the molecular formula C21H20N4O3
and a molecular weight of 376.42 g/mol. Its IUPAC name is 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine.
Molecular Properties
| Compound Name | 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine |
| PubChem CID | 25060408 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COCCOc1cc2ncc3c(N)nc(-c4cccnc4)cc3c2cc1OC |
| InChI | InChI=1S/C21H20N4O3/c1-26-6-7-28-20-10-18-15(9-19(20)27-2)14-8-17(13-4-3-5-23-11-13)25-21(22)16(14)12-24-18/h3-5,8-12H,6-7H2,1-2H3,(H2,22,25) |
| InChIKey | GVERHDSKRDVXKR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine?
The IUPAC name of 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine (CID 25060408) is 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine.
What is the SMILES notation for 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine?
The canonical SMILES for 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine is COCCOc1cc2ncc3c(N)nc(-c4cccnc4)cc3c2cc1OC.
What is the InChIKey of 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine?
The InChIKey is GVERHDSKRDVXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3/c1-26-6-7-28-20-10-18-15(9-19(20)27-2)14-8-17(13-4-3-5-23-11-13)25-21(22)16(14)12-24-18/h3-5,8-12H,6-7H2,1-2H3,(H2,22,25).
What are the key properties of 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine?
9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine has a molecular weight of 376.42 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-8-(2-methoxyethoxy)-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine is sourced from PubChem (CID 25060408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).