C28H26ClN5O3 — CID 25060411
2-[5-[(2S)-2-amino-3-(3-chlorophenyl)propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 25060411) has the molecular formula C28H26ClN5O3 and a molecular weight of 516.00 g/mol. Its IUPAC name is 2-[5-[(2S)-2-amino-3-(3-chlorophenyl)propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[(2S)-2-amino-3-(3-chlorophenyl)propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 25060411 |
| Molecular Formula | C28H26ClN5O3 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[5-[(2S)-2-amino-3-(3-chlorophenyl)propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(OC[C@@H](N)Cc5cccc(Cl)c5)c4)cc3c2cc1OC |
| InChI | InChI=1S/C28H26ClN5O3/c1-35-26-10-22-21-9-24(34-28(31)23(21)14-33-25(22)11-27(26)36-2)17-8-20(13-32-12-17)37-15-19(30)7-16-4-3-5-18(29)6-16/h3-6,8-14,19H,7,15,30H2,1-2H3,(H2,31,34)/t19-/m0/s1 |
| InChIKey | YHWXSMVLIYQGKB-IBGZPJMESA-N |
| XLogP | 5.05 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|