C21H29F3N2O3S — CID 25060422
2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propane-1,3-diol (PubChem CID 25060422) has the molecular formula C21H29F3N2O3S and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propane-1,3-diol.
| Compound Name | 2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 25060422 |
| Molecular Formula | C21H29F3N2O3S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propane-1,3-diol |
| SMILES | CCCCCCCCOc1ccc(-c2cnc(C(N)(CO)CO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H29F3N2O3S/c1-2-3-4-5-6-7-10-29-17-9-8-15(11-16(17)21(22,23)24)18-12-26-19(30-18)20(25,13-27)14-28/h8-9,11-12,27-28H,2-7,10,13-14,25H2,1H3 |
| InChIKey | QGVWLQIOOMUCEX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|