C29H48O6 — CID 25060511
(6aS,10R,11S,12aR)-10,11,14,14a-tetrahydroxy-2,2,6a,9,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid (PubChem CID 25060511) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is (6aS,10R,11S,12aR)-10,11,14,14a-tetrahydroxy-2,2,6a,9,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid.
| Compound Name | (6aS,10R,11S,12aR)-10,11,14,14a-tetrahydroxy-2,2,6a,9,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 25060511 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (6aS,10R,11S,12aR)-10,11,14,14a-tetrahydroxy-2,2,6a,9,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CC[C@@]3(C)C4CCC5C(C)(C)[C@@H](O)[C@@H](O)C[C@]5(C)C4CC(O)C3(O)C2C1 |
| InChI | InChI=1S/C29H48O6/c1-24(2)9-11-28(23(33)34)12-10-27(6)16-7-8-19-25(3,4)22(32)18(30)14-26(19,5)17(16)13-21(31)29(27,35)20(28)15-24/h16-22,30-32,35H,7-15H2,1-6H3,(H,33,34)/t16?,17?,18-,19?,20?,21?,22-,26+,27-,28?,29?/m0/s1 |
| InChIKey | OPCDKMGUXDEMEK-ALVCBRKCSA-N |
| XLogP | 3.98 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |