About (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one
(9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one (PubChem CID 25060552) has the molecular formula C12H13BrO3
and a molecular weight of 285.14 g/mol. Its IUPAC name is (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one.
Molecular Properties
| Compound Name | (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one |
| PubChem CID | 25060552 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one |
| SMILES | O=C1C23C=C(Br)C(CC2CCOC3)[C@@]12CO2 |
| InChI | InChI=1S/C12H13BrO3/c13-9-4-11-5-15-2-1-7(11)3-8(9)12(6-16-12)10(11)14/h4,7-8H,1-3,5-6H2/t7?,8?,11?,12-/m0/s1 |
| InChIKey | LQCSCPJEWKACNP-OLYDNFLYSA-N |
| XLogP | 1.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one?
The IUPAC name of (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one (CID 25060552) is (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one.
What is the SMILES notation for (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one?
The canonical SMILES for (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one is O=C1C23C=C(Br)C(CC2CCOC3)[C@@]12CO2.
What is the InChIKey of (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one?
The InChIKey is LQCSCPJEWKACNP-OLYDNFLYSA-N. The full InChI is InChI=1S/C12H13BrO3/c13-9-4-11-5-15-2-1-7(11)3-8(9)12(6-16-12)10(11)14/h4,7-8H,1-3,5-6H2/t7?,8?,11?,12-/m0/s1.
What are the key properties of (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one?
(9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one has a molecular weight of 285.14 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-12-bromospiro[3-oxatricyclo[6.2.2.01,6]dodec-11-ene-9,2'-oxirane]-10-one is sourced from PubChem (CID 25060552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).