C19H21N5O — CID 25060728
1-(2,4-diaminoquinazolin-7-yl)-3,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 25060728) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(2,4-diaminoquinazolin-7-yl)-3,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(2,4-diaminoquinazolin-7-yl)-3,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 25060728 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-(2,4-diaminoquinazolin-7-yl)-3,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1cn(-c2ccc3c(N)nc(N)nc3c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H21N5O/c1-10-9-24(14-7-19(2,3)8-15(25)16(10)14)11-4-5-12-13(6-11)22-18(21)23-17(12)20/h4-6,9H,7-8H2,1-3H3,(H4,20,21,22,23) |
| InChIKey | FVMXVFZACNXLHD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |