C26H18Cl2N2O3S2 — CID 25061320
3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-5-[4-[2-(1,3-thiazol-4-yl)ethynyl]phenyl]thiophene-2-carboxylic acid (PubChem CID 25061320) has the molecular formula C26H18Cl2N2O3S2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-5-[4-[2-(1,3-thiazol-4-yl)ethynyl]phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-5-[4-[2-(1,3-thiazol-4-yl)ethynyl]phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 25061320 |
| Molecular Formula | C26H18Cl2N2O3S2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | 3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]-5-[4-[2-(1,3-thiazol-4-yl)ethynyl]phenyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)cc1Cl)c1cc(-c2ccc(C#Cc3cscn3)cc2)sc1C(=O)O |
| InChI | InChI=1S/C26H18Cl2N2O3S2/c1-15(2)30(25(31)20-10-8-18(27)11-21(20)28)22-12-23(35-24(22)26(32)33)17-6-3-16(4-7-17)5-9-19-13-34-14-29-19/h3-4,6-8,10-15H,1-2H3,(H,32,33) |
| InChIKey | MRFUCSKJBBJVBS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|