About methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate
methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate (PubChem CID 25061365) has the molecular formula C21H24N2O6
and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate |
| PubChem CID | 25061365 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O6/c1-29-21(28)16(23-19(26)14-8-3-2-4-9-14)11-5-6-13-22-20(27)15-10-7-12-17(24)18(15)25/h2-4,7-10,12,16,24-25H,5-6,11,13H2,1H3,(H,22,27)(H,23,26)/t16-/m0/s1 |
| InChIKey | DDMXJNUMEOKUJJ-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate?
The IUPAC name of methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate (CID 25061365) is methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate.
What is the SMILES notation for methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate?
The canonical SMILES for methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate is COC(=O)[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1ccccc1.
What is the InChIKey of methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate?
The InChIKey is DDMXJNUMEOKUJJ-INIZCTEOSA-N. The full InChI is InChI=1S/C21H24N2O6/c1-29-21(28)16(23-19(26)14-8-3-2-4-9-14)11-5-6-13-22-20(27)15-10-7-12-17(24)18(15)25/h2-4,7-10,12,16,24-25H,5-6,11,13H2,1H3,(H,22,27)(H,23,26)/t16-/m0/s1.
What are the key properties of methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate?
methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate has a molecular weight of 400.43 g/mol, XLogP of 1.97, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-benzamido-6-[(2,3-dihydroxybenzoyl)amino]hexanoate is sourced from PubChem (CID 25061365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).