C26H40N4O — CID 25061548
N-[[4-(diethylamino)phenyl]methyl]-N-[4-(dimethylamino)phenyl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 25061548) has the molecular formula C26H40N4O and a molecular weight of 424.63 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-N-[4-(dimethylamino)phenyl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-N-[4-(dimethylamino)phenyl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 25061548 |
| Molecular Formula | C26H40N4O |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-N-[4-(dimethylamino)phenyl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CCN(CC)c1ccc(CN(C(=O)C(CC(C)C)NC)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H40N4O/c1-8-29(9-2)23-12-10-21(11-13-23)19-30(26(31)25(27-5)18-20(3)4)24-16-14-22(15-17-24)28(6)7/h10-17,20,25,27H,8-9,18-19H2,1-7H3 |
| InChIKey | AWNPAJHNJBVHIR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|