C20H17F3N8O3 — CID 25061932
3-nitro-6-N-[2-[[7-[4-(trifluoromethoxy)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,6-diamine (PubChem CID 25061932) has the molecular formula C20H17F3N8O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is 3-nitro-6-N-[2-[[7-[4-(trifluoromethoxy)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,6-diamine.
| Compound Name | 3-nitro-6-N-[2-[[7-[4-(trifluoromethoxy)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 25061932 |
| Molecular Formula | C20H17F3N8O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-nitro-6-N-[2-[[7-[4-(trifluoromethoxy)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2nc(-c3ccc(OC(F)(F)F)cc3)cc3nccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17F3N8O3/c21-20(22,23)34-13-3-1-12(2-4-13)14-11-17-26-9-10-30(17)19(28-14)27-8-7-25-16-6-5-15(31(32)33)18(24)29-16/h1-6,9-11H,7-8H2,(H,27,28)(H3,24,25,29) |
| InChIKey | VLRDRPJDXVEKFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|