C21H17N7O2 — CID 25061937
6-[2-[[7-(1,3-benzodioxol-5-yl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 25061937) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 6-[2-[[7-(1,3-benzodioxol-5-yl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[7-(1,3-benzodioxol-5-yl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25061937 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 6-[2-[[7-(1,3-benzodioxol-5-yl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2nc(-c3ccc4c(c3)OCO4)cc3nccn23)nc1 |
| InChI | InChI=1S/C21H17N7O2/c22-11-14-1-4-19(26-12-14)23-5-6-25-21-27-16(10-20-24-7-8-28(20)21)15-2-3-17-18(9-15)30-13-29-17/h1-4,7-10,12H,5-6,13H2,(H,23,26)(H,25,27) |
| InChIKey | IAKLTNFYUZFNAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|