About (3E)-3-(2,2-dimethoxyethylidene)octan-2-one
(3E)-3-(2,2-dimethoxyethylidene)octan-2-one (PubChem CID 25062092) has the molecular formula C12H22O3
and a molecular weight of 214.31 g/mol. Its IUPAC name is (3E)-3-(2,2-dimethoxyethylidene)octan-2-one.
Molecular Properties
| Compound Name | (3E)-3-(2,2-dimethoxyethylidene)octan-2-one |
| PubChem CID | 25062092 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (3E)-3-(2,2-dimethoxyethylidene)octan-2-one |
| SMILES | CCCCC/C(=C\C(OC)OC)C(C)=O |
| InChI | InChI=1S/C12H22O3/c1-5-6-7-8-11(10(2)13)9-12(14-3)15-4/h9,12H,5-8H2,1-4H3/b11-9+ |
| InChIKey | RYCDBJNEYHOGLV-PKNBQFBNSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(2,2-dimethoxyethylidene)octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(2,2-dimethoxyethylidene)octan-2-one?
The IUPAC name of (3E)-3-(2,2-dimethoxyethylidene)octan-2-one (CID 25062092) is (3E)-3-(2,2-dimethoxyethylidene)octan-2-one.
What is the SMILES notation for (3E)-3-(2,2-dimethoxyethylidene)octan-2-one?
The canonical SMILES for (3E)-3-(2,2-dimethoxyethylidene)octan-2-one is CCCCC/C(=C\C(OC)OC)C(C)=O.
What is the InChIKey of (3E)-3-(2,2-dimethoxyethylidene)octan-2-one?
The InChIKey is RYCDBJNEYHOGLV-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-6-7-8-11(10(2)13)9-12(14-3)15-4/h9,12H,5-8H2,1-4H3/b11-9+.
What are the key properties of (3E)-3-(2,2-dimethoxyethylidene)octan-2-one?
(3E)-3-(2,2-dimethoxyethylidene)octan-2-one has a molecular weight of 214.31 g/mol, XLogP of 2.70, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(2,2-dimethoxyethylidene)octan-2-one is sourced from PubChem (CID 25062092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).