C15H17N7OS — CID 25062252
3-methyl-9-pentyl-7-(1,3-thiazol-2-yl)-6H-[1,2,4]triazolo[4,3-a]purin-5-one (PubChem CID 25062252) has the molecular formula C15H17N7OS and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-methyl-9-pentyl-7-(1,3-thiazol-2-yl)-6H-[1,2,4]triazolo[4,3-a]purin-5-one.
| Compound Name | 3-methyl-9-pentyl-7-(1,3-thiazol-2-yl)-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
|---|---|
| PubChem CID | 25062252 |
| Molecular Formula | C15H17N7OS |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-methyl-9-pentyl-7-(1,3-thiazol-2-yl)-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
| SMILES | CCCCCn1c2nc(-c3nccs3)[nH]c2c(=O)n2c(C)nnc12 |
| InChI | InChI=1S/C15H17N7OS/c1-3-4-5-7-21-12-10(14(23)22-9(2)19-20-15(21)22)17-11(18-12)13-16-6-8-24-13/h6,8H,3-5,7H2,1-2H3,(H,17,18) |
| InChIKey | QZGAUACABZSYIU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|