C22H25F3N2O3 — CID 25062396
N-[(2R)-8-[2-(ethylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 25062396) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[(2R)-8-[2-(ethylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(2R)-8-[2-(ethylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 25062396 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[(2R)-8-[2-(ethylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCNCCOc1cccc2c1C[C@H](NC(=O)c1ccc(OC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C22H25F3N2O3/c1-2-26-12-13-29-20-5-3-4-15-6-9-17(14-19(15)20)27-21(28)16-7-10-18(11-8-16)30-22(23,24)25/h3-5,7-8,10-11,17,26H,2,6,9,12-14H2,1H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | KSNXOLOUXLCDGM-QGZVFWFLSA-N |
| XLogP | 3.86 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|