C33H33N5O5 — CID 25062532
1-(5-tert-butyl-2-methoxyphenyl)-3-[4-(2-piperidin-1-ylpyrimidin-4-yl)oxynaphthalen-1-yl]imidazolidine-2,4,5-trione (PubChem CID 25062532) has the molecular formula C33H33N5O5 and a molecular weight of 579.66 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methoxyphenyl)-3-[4-(2-piperidin-1-ylpyrimidin-4-yl)oxynaphthalen-1-yl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[4-(2-piperidin-1-ylpyrimidin-4-yl)oxynaphthalen-1-yl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 25062532 |
| Molecular Formula | C33H33N5O5 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[4-(2-piperidin-1-ylpyrimidin-4-yl)oxynaphthalen-1-yl]imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(C(C)(C)C)cc1N1C(=O)C(=O)N(c2ccc(Oc3ccnc(N4CCCCC4)n3)c3ccccc23)C1=O |
| InChI | InChI=1S/C33H33N5O5/c1-33(2,3)21-12-14-27(42-4)25(20-21)38-30(40)29(39)37(32(38)41)24-13-15-26(23-11-7-6-10-22(23)24)43-28-16-17-34-31(35-28)36-18-8-5-9-19-36/h6-7,10-17,20H,5,8-9,18-19H2,1-4H3 |
| InChIKey | QMJFLPCFJWVFBL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|