C18H12N2O — CID 25062577
14-oxa-3,10-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,12,17(21),18-nonaene (PubChem CID 25062577) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is 14-oxa-3,10-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,12,17(21),18-nonaene.
| Compound Name | 14-oxa-3,10-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,12,17(21),18-nonaene |
|---|---|
| PubChem CID | 25062577 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 14-oxa-3,10-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,12,17(21),18-nonaene |
| SMILES | c1ccc2nc3c(cc4c5c(cccc53)CCO4)nc2c1 |
| InChI | InChI=1S/C18H12N2O/c1-2-7-14-13(6-1)19-15-10-16-17-11(8-9-21-16)4-3-5-12(17)18(15)20-14/h1-7,10H,8-9H2 |
| InChIKey | GYEBIAMPHKIJOQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|