C19H20N4O — CID 25063092
1-(4-aminoquinazolin-7-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 25063092) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(4-aminoquinazolin-7-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(4-aminoquinazolin-7-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 25063092 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-(4-aminoquinazolin-7-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1cc2c(n1-c1ccc3c(N)ncnc3c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C19H20N4O/c1-11-6-14-16(8-19(2,3)9-17(14)24)23(11)12-4-5-13-15(7-12)21-10-22-18(13)20/h4-7,10H,8-9H2,1-3H3,(H2,20,21,22) |
| InChIKey | GZYLTCACCHHUBR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|