C20H22N4O — CID 25063093
1-(4-aminoquinazolin-7-yl)-2,3,6,6-tetramethyl-5,7-dihydroindol-4-one (PubChem CID 25063093) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(4-aminoquinazolin-7-yl)-2,3,6,6-tetramethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(4-aminoquinazolin-7-yl)-2,3,6,6-tetramethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 25063093 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(4-aminoquinazolin-7-yl)-2,3,6,6-tetramethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1c2c(n(-c3ccc4c(N)ncnc4c3)c1C)CC(C)(C)CC2=O |
| InChI | InChI=1S/C20H22N4O/c1-11-12(2)24(16-8-20(3,4)9-17(25)18(11)16)13-5-6-14-15(7-13)22-10-23-19(14)21/h5-7,10H,8-9H2,1-4H3,(H2,21,22,23) |
| InChIKey | ULVOSIZKLPPTGZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |